Molecule Details
| InChIKey | HCDMJFOHIXMBOV-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pemigatinib |
| Canonical SMILES | CCN1C(=O)N(c2c(F)c(OC)cc(OC)c2F)Cc2cnc3[nH]c(CN4CCOCC4)cc3c21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.77 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15102 |
|---|---|
| Drug Name | Pemigatinib |
| CAS Number | 1513857-77-6 |
| Groups | approved investigational |
| ATC Codes | L01EN02 |
| Description | Pemigatinib is a small molecule kinase inhibitor with antitumour activity. It works by inhibiting fibroblast growth factor receptors (FGFRs), which are receptor tyrosine kinases that activate signalling pathways in tumour cells.[A193719] FGFRs gained attention as potential therapeutic targets in sel... |
Categories: Antineoplastic Agents Antineoplastic and Immunomodulating Agents BCRP/ABCG2 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Fibroblast Growth Factor 2, antagonists & inhibitors Fibroblast growth factor receptor (FGFR) tyrosine kinase inhibitors Kinase Inhibitor MATE 1 Inhibitors MATE inhibitors OCT2 Inhibitors Oxazines P-glycoprotein inhibitors P-glycoprotein substrates Protein Kinase Inhibitors Receptor, Fibroblast Growth Factor, Type 1, antagonists & inhibitors Receptor, Fibroblast Growth Factor, Type 2, antagonists & inhibitors Receptors, Fibroblast Growth Factor, antagonists & inhibitors
Cross-references: BindingDB: 301310 CHEMBL4297522 ChemSpider: 68007304 Drugs Product Database (DPD): 23643 PDB: 8ZF RxCUI: 2359268 Wikipedia: Pemigatinib
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P11362 | FGFR1 | Homo sapiens | Human | PF07679 PF00047 PF07714 | 9.4 | IC50 | ChEMBL;BindingDB |
| P21802 | FGFR2 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 9.3 | IC50 | ChEMBL;BindingDB |
| P22607 | FGFR3 | Homo sapiens | Human | PF21165 PF07679 PF13927 PF07714 | 8.8 | IC50 | ChEMBL;BindingDB |
| P22455 | FGFR4 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 7.5 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P11362 | FGFR1 | Fibroblast growth factor receptor 1 | inhibitor | targets |
| P21802 | FGFR2 | Fibroblast growth factor receptor 2 | inhibitor | targets |
| P22455 | FGFR4 | Fibroblast growth factor receptor 4 | inhibitor | targets |
| P22607 | FGFR3 | Fibroblast growth factor receptor 3 | inhibitor | targets |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |