Molecule Details
| InChIKey | GZUITABIAKMVPG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Raloxifene |
| Canonical SMILES | O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 22 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.13 |
| Source | ChEMBL;BindingDB;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00481 |
|---|---|
| Drug Name | Raloxifene |
| CAS Number | 84449-90-1 |
| Groups | approved investigational |
| ATC Codes | G03XC01 |
| Description | Raloxifene is a second generation selective estrogen receptor modulator (SERM) that mediates anti-estrogenic effects on breast and uterine tissues, and estrogenic effects on bone, lipid metabolism, and blood coagulation.[A4979,T28] Exhibiting tissue-specific effects distinct from [estradiol], raloxi... |
Categories: BCRP/ABCG2 Substrates Benzene Derivatives Benzylidene Compounds Bone Density Conservation Agents Cytochrome P-450 CYP2B6 Inhibitors Cytochrome P-450 CYP2B6 Inhibitors (strong) Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (strength unknown) Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (strength unknown) Cytochrome P-450 Enzyme Inhibitors Estrogen Agonist-antagonists Estrogen Agonist/Antagonist Estrogen Antagonists Estrogen Receptor Modulators Genito Urinary System and Sex Hormones Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists OATP1B1/SLCO1B1 Substrates OATP1B3 substrates P-glycoprotein substrates Selective Estrogen Receptor Modulators Sex Hormones and Modulators of the Genital System Stilbenes UGT1A1 Substrates
Cross-references: BindingDB: 19441 ChEBI: 8772 CHEMBL81 ChemSpider: 4859 Drugs Product Database (DPD): 11811 Guide to Pharmacology: 2820 IUPHAR: 2820 C07228 PDB: RAL PharmGKB: PA451221 PubChem:5035 PubChem:46506514 RxCUI: 72143 Therapeutic Targets Database: DAP000792 Wikipedia: Raloxifene ZINC: ZINC000000538275
Target Activities (22)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 9.7 | pIC50 | TTD_MultiTarget |
| Q15125 | EBP | Homo sapiens | Human | PF05241 | 9.0 | Ki | ChEMBL;BindingDB |
| Q06278 | AOX1 | Homo sapiens | Human | PF01315 PF03450 PF00941 PF00111 PF01799 PF02738 PF20256 | 8.8 | Ki | ChEMBL;BindingDB |
| P03372 | ESR1 | Homo sapiens | Human | PF12743 PF00104 PF02159 PF00105 | 8.7 | IC50 | ChEMBL;BindingDB |
| Q92731 | ESR2 | Homo sapiens | Human | PF12497 PF00104 PF00105 | 7.9 | IC50 | ChEMBL;BindingDB |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 7.0 | Ki | ChEMBL;BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P23975 | SLC6A2 | Homo sapiens | Human | PF00209 | 6.5 | IC50 | ChEMBL |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.4 | Ki | ChEMBL |
| P22303 | ACHE | Homo sapiens | Human | PF08674 PF00135 | 6.4 | IC50 | ChEMBL |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.4 | Ki | ChEMBL |
| P35372 | OPRM1 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P41145 | OPRK1 | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 6.2 | IC50 | ChEMBL |
| P01031 | C5 | Homo sapiens | Human | PF00207 PF07703 PF07677 PF01821 PF21309 PF17790 PF01835 PF17791 PF17789 PF01759 PF07678 | 6.2 | Kd | ChEMBL;BindingDB |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL;BindingDB |
| Q96WX4 | erg6 | Pneumocystis carinii (strain B80) | Pathogen | PF08241 PF08498 | 9.7 | pIC50 | TTD_MultiTarget |
| P32352 | ERG2 | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) | Pathogen | PF04622 | 7.2 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (21)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P11511 | CYP19A1 | Aromatase | inhibitor | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | inhibitor | enzymes |
| Q06278 | AOX1 | Aldehyde oxidase | inhibitor | enzymes |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | substrate | enzymes |
| Q9HAW8 | Q9HAW8 | UDP-glucuronosyltransferase 1A10 | substrate | enzymes |
| Q9HAW9 | Q9HAW9 | UDP-glucuronosyltransferase 1A8 | substrate | enzymes |
| P03372 | ESR1 | Estrogen receptor | agonist | targets |
| Q92731 | ESR2 | Estrogen receptor beta | agonist | targets |
| P04155 | P04155 | Trefoil factor 1 | binder | targets |
| P50453 | P50453 | Serpin B9 | binder | targets |
| O15438 | ABCC3 | ATP-binding cassette sub-family C member 3 | substrate | transporters |
| O15439 | O15439 | ATP-binding cassette sub-family C member 4 | substrate | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q92887 | ABCC2 | ATP-binding cassette sub-family C member 2 | substrate | transporters |
| Q9NPD5 | SLCO1B3 | Solute carrier organic anion transporter family member 1B3 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | substrate | transporters |