Molecule Details
| InChIKey | GYOZYWVXFNDGLU-XLPZGREQSA-N |
|---|---|
| Canonical SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)[nH]c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.04 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01643 |
|---|---|
| Drug Name | Thymidine monophosphate |
| CAS Number | 365-07-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | 5-Thymidylic acid. A thymine nucleotide containing one phosphate group esterified to the deoxyribose moiety. |
Categories: Deoxyribonucleotides Nucleic Acids, Nucleotides, and Nucleosides Nucleotides Pyrimidine Nucleotides Pyrimidines Thymine Nucleotides
Cross-references: BindingDB: 50332929 ChEBI: 17013 CHEMBL394429 ChemSpider: 9319 C00364 PDB: DT PubChem:9700 PubChem:46504719 Wikipedia: Thymidine_monophosphate ZINC: ZINC000001678872
Target Activities (2)
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O52806 | O52806 | PCZA361.16 | binder | targets |
| P03007 | P03007 | DNA polymerase III subunit epsilon | binder | targets |
| P06612 | topA | DNA topoisomerase 1 | binder | targets |
| Q9HU22 | Q9HU22 | Glucose-1-phosphate thymidylyltransferase | binder | targets |
| P04183 | TK1 | Thymidine kinase, cytosolic | inhibitor | targets |
| P12461 | P12461 | Thymidylate synthase | inhibitor | targets |
| P00469 | thyA | Thymidylate synthase | product of | targets |
| P04818 | TYMS | Thymidylate synthase | product of | targets |
| P23919 | P23919 | Thymidylate kinase | product of | targets |
| P9WKE1 | tmk | Thymidylate kinase | product of | targets |