Molecule Details
| InChIKey | GUJRSXAPGDDABA-NSHDSACASA-N |
|---|---|
| Compound Name | Remoxipride |
| Canonical SMILES | CCN1CCC[C@H]1CNC(=O)c1c(OC)ccc(Br)c1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.65 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00409 |
|---|---|
| Drug Name | Remoxipride |
| CAS Number | 80125-14-0 |
| Groups | approved withdrawn |
| ATC Codes | N05AL04 |
| Description | Remoxipride is an atypical antipsychotic agent that is specific for dopamine D<sub>2</sub> receptors.[A215422] It gained approval in the UK in 1989 but was withdrawn in 1993 after it was found to be associated with an increased incidence of aplastic anemia.[A215422,A215512] |
Categories: Acids, Carbocyclic Amides Antipsychotic Agents Benzamides and benzamide derivatives Benzene Derivatives Benzoates Bromobenzoates Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (strength unknown) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Nervous System Neurotoxic agents Neurotransmitter Agents Psycholeptics Psychotropic Drugs Tranquilizing Agents
Cross-references: BindingDB: 50026045 ChEBI: 92948 CHEMBL22242 ChemSpider: 49195 PharmGKB: PA164749051 PubChem:54477 PubChem:46508689 RxCUI: 35350 Therapeutic Targets Database: DAP000312 Wikipedia: Remoxipride ZINC: ZINC000002021799
Target Activities (4)
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | alpha1-acid glycoprotein | binder | carriers |
| P00176 | Cyp2b1 | Cytochrome P450 2B1 | inhibitor | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A Subfamily | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P21917 | DRD4 | D(4) dopamine receptor | antagonist | targets |
| P35462 | DRD3 | D(3) dopamine receptor | antagonist | targets |
| Q99720 | SIGMAR1 | Sigma non-opioid intracellular receptor 1 | antagonist | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | other/unknown | targets |