Molecule Details
| InChIKey | GTQPEQGDLVSFJO-CXAGYDPISA-N |
|---|---|
| Canonical SMILES | Cc1cnc(-c2cc(O[C@@H]3CCOC3)cc(C(=O)N[C@H](C)c3cnc(C(F)(F)F)nc3)c2)s1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.45 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21465 |
|---|---|
| Drug Name | Eliapixant |
| CAS Number | 1948229-21-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Eliapixant is a small molecule drug. The usage of the INN stem '-pixant' in the name indicates that Eliapixant is a purinoreceptor (P2X) antagonist. Eliapixant is under investigation in clinical trial NCT04614246 (Study to Gather Information How Well Three Different Doses of BAY1817080 Given Twice D... |
Cross-references: BindingDB: 319844 CHEMBL5095224