Molecule Details
| InChIKey | GRSZFWQUAKGDAV-KQYNXXCUSA-N |
|---|---|
| Canonical SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.6 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04566 |
|---|---|
| Drug Name | Inosinic Acid |
| CAS Number | 131-99-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Inosine 5'-Monophosphate. A purine nucleotide which has hypoxanthine as the base and one phosphate group esterified to the sugar moiety. |
Categories: Heterocyclic Compounds, Fused-Ring Inosine Nucleotides Nucleic Acids, Nucleotides, and Nucleosides Nucleotides Purine Nucleotides Purines Ribonucleotides
Cross-references: BindingDB: 19254 ChEBI: 17202 CHEMBL1207374 ChemSpider: 8264 C00130 PDB: IMP PubChem:8582 PubChem:46504691 RxCUI: 5832 Wikipedia: Inosinic_acid ZINC: ZINC000004228242
Target Activities (2)
DrugBank Target Actions (11)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P0A7D4 | P0A7D4 | Adenylosuccinate synthetase | binder | targets |
| P0A9M2 | P0A9M2 | Hypoxanthine phosphoribosyltransferase | binder | targets |
| P0C0H6 | guaB | Inosine-5'-monophosphate dehydrogenase | binder | targets |
| Q27796 | Q27796 | Hypoxanthine phosphoribosyltransferase | binder | targets |
| Q83P33 | Q83P33 | Adenylosuccinate synthetase | binder | targets |
| Q8N142 | Q8N142 | Adenylosuccinate synthetase isozyme 1 | binder | targets |
| P11217 | PYGM | Glycogen phosphorylase, muscle form | inhibitor | targets |
| P12268 | IMPDH2 | Inosine-5'-monophosphate dehydrogenase 2 | inhibitor | targets |
| P20035 | LACZ | Hypoxanthine-guanine-xanthine phosphoribosyltransferase | inhibitor | targets |
| P20839 | IMPDH1 | Inosine-5'-monophosphate dehydrogenase 1 | inhibitor | targets |
| Q9U8D3 | Q9U8D3 | Adenylosuccinate synthetase | inhibitor | targets |