Molecule Details
| InChIKey | GOTYRUGSSMKFNF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Lenalidomide |
| Canonical SMILES | Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.57 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00480 |
|---|---|
| Drug Name | Lenalidomide |
| CAS Number | 191732-72-6 |
| Groups | approved investigational |
| ATC Codes | L04AX04 |
| Description | Lenalidomide (previously referred to as CC-5013) is an immunomodulatory drug with potent antineoplastic, anti-angiogenic, and anti-inflammatory properties.[A228553] It is a 4-amino-glutamyl analogue of [thalidomide] [A228543] and like thalidomide, lenalidomide exists as a racemic mixture of the acti... |
Categories: Acids, Carbocyclic Angiogenesis Inhibitors Angiogenesis Modulating Agents Antineoplastic Agents Antineoplastic and Immunomodulating Agents Drugs that are Mainly Renally Excreted Growth Inhibitors Growth Substances Heterocyclic Compounds, Fused-Ring Imides Immunologic Factors Immunosuppressive Agents Isoindoles Myelosuppressive Agents P-glycoprotein substrates Phthalic Acids Phthalimides Piperidines Piperidones Thalidomide Analog Tumor Necrosis Factor Blockers
Cross-references: BindingDB: 65454 ChEBI: 63791 CHEMBL848 ChemSpider: 187515 Drugs Product Database (DPD): 20185 D04687 PharmGKB: PA162363968 PubChem:216326 PubChem:46505725 RxCUI: 342369 Therapeutic Targets Database: DAP001255 Wikipedia: Lenalidomide
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q96SW2 | CRBN | Homo sapiens | Human | PF02190 PF03226 | 6.8 | IC50 | ChEMBL;BindingDB |
| Q14676 | MDC1 | Homo sapiens | Human | PF16589 PF00498 PF16770 | 6.7 | IC50 | BindingDB |
| P01375 | TNF | Homo sapiens | Human | PF00229 | 6.7 | IC50 | ChEMBL;BindingDB |
| Q16531 | DDB1 | Homo sapiens | Human | PF10433 PF23726 PF03178 | 6.7 | IC50 | ChEMBL |
| P01584 | IL1B | Homo sapiens | Human | PF00340 PF02394 | 6.4 | IC50 | ChEMBL;BindingDB |
| Q9UKS7 | IKZF2 | Homo sapiens | Human | PF00096 | 6.3 | IC50 | BindingDB |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P33151 | P33151 | Cadherin-5 | antagonist | targets |
| O14788 | TNFSF11 | Tumor necrosis factor ligand superfamily member 11 | inhibitor | targets |
| P01375 | TNF | Tumor necrosis factor | inhibitor | targets |
| Q96SW2 | CRBN | Protein cereblon | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | negative modulator | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |