Molecule Details
| InChIKey | GOHUJGMYCZDYDF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ritolukast |
| Canonical SMILES | O=S(=O)(Nc1cccc(OCc2ccc3ccccc3n2)c1)C(F)(F)F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.46 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19517 |
|---|---|
| Drug Name | Ritolukast |
| CAS Number | 111974-60-8 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Ritolukast is a small molecule drug. The usage of the INN stem '-lukast' in the name indicates that Ritolukast is a leukotriene receptor antagonist. Ritolukast has a monoisotopic molecular weight of 382.06 Da. |
Categories: Heterocyclic Compounds, Fused-Ring Quinolines
Cross-references: BindingDB: 50006806 CHEMBL17344