Molecule Details
| InChIKey | GNWCRBFQZDJFTI-UHFFFAOYSA-N |
|---|---|
| Compound Name | Nitraquazone |
| Canonical SMILES | CCn1c(=O)c2ccccc2n(-c2cccc([N+](=O)[O-])c2)c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.3 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19659 |
|---|---|
| Drug Name | Nitraquazone |
| CAS Number | 56739-21-0 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Nitraquazone is a small molecule drug. The usage of the INN stem '-azone' in the name indicates that Nitraquazone is a anti-inflammatory analgesic, phenylbutazone derivative. Nitraquazone has a monoisotopic molecular weight of 311.09 Da. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50218545 CHEMBL88990 ZINC: ZINC000000001819
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 7.3 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 7.3 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 7.3 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 7.3 | IC50 | ChEMBL |