Molecule Details
| InChIKey | GMYLVKUGJMYTFB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Cc-115 |
| Canonical SMILES | CCN1C(=O)CNc2ncc(-c3ccc(-c4nc[nH]n4)nc3C)nc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.04 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12740 |
|---|---|
| Drug Name | CC-115 |
| CAS Number | 1228013-15-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CC-115 has been used in trials studying the treatment of Prostate Cancer, Neoplasm Metastasis, Ewing's Osteosarcoma, Glioblastoma Multiforme, and Chronic Lymphocytic Leukemia, among others. |
Cross-references: BindingDB: 50093082 CHEMBL3586573 ChemSpider: 35308328 PubChem:58298318 PubChem:347828930 ZINC: ZINC000113191351
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P78527 | PRKDC | Homo sapiens | Human | PF20500 PF20502 PF08163 PF19704 PF02259 PF02260 PF00454 | 7.9 | IC50 | ChEMBL;BindingDB |
| P42345 | MTOR | Homo sapiens | Human | PF02259 PF02260 PF08771 PF23593 PF11865 PF00454 | 7.7 | IC50 | ChEMBL;BindingDB |
| Q8N122 | RPTOR | Homo sapiens | Human | PF02985 PF14538 PF00400 | 7.6 | IC50 | ChEMBL |
| Q9BVC4 | MLST8 | Homo sapiens | Human | PF00400 | 7.6 | IC50 | ChEMBL |
| Q13370 | PDE3B | Homo sapiens | Human | PF00233 | 6.2 | IC50 | ChEMBL |
| Q14432 | PDE3A | Homo sapiens | Human | PF00233 | 6.2 | IC50 | ChEMBL;BindingDB |
| P42336 | PIK3CA | Homo sapiens | Human | PF00454 PF00792 PF02192 PF00794 PF00613 | 6.1 | IC50 | ChEMBL;BindingDB |