Molecule Details
| InChIKey | GMJFVGRUYJHMCO-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | N=C(N)c1ccc(OCCCOc2ccc(C(=N)N)cc2Br)c(Br)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.14 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13548 |
|---|---|
| Drug Name | Dibrompropamidine |
| CAS Number | 496-00-4 |
| Groups | experimental |
| ATC Codes | D08AC01 S01AX14 |
| Description | nan |
Categories: Amidines Anti-Infective Agents Anti-Infective Agents, Local Antiseptics and Disinfectants Biguanides and Amidines Dermatologicals Ophthalmologicals Sensory Organs
Cross-references: BindingDB: 50098554 ChEBI: 135760 CHEMBL30044 ChemSpider: 11479 RxCUI: 22865 Wikipedia: Dibrompropamidine ZINC: ZINC000001665651