Molecule Details
| InChIKey | GKPHAIOJCHBZCT-HXUWFJFHSA-N |
|---|---|
| Canonical SMILES | Cc1ccc(C(=O)N2CCOC[C@H]2Cc2cccc(-n3nccn3)c2)c(-n2nccn2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.63 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21506 |
|---|---|
| Drug Name | Nivasorexant |
| CAS Number | 1435480-40-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Nivasorexant is a small molecule drug. The usage of the INN stem '-orexant' in the name indicates that Nivasorexant is a orexin receptor antagonist. Nivasorexant has a monoisotopic molecular weight of 429.19 Da. |
Cross-references: BindingDB: 183990 CHEMBL3892369