Molecule Details
| InChIKey | GKNPSSNBBWDAGH-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | C[N+]1(C)CCCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.68 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04843 |
|---|---|
| Drug Name | Mepenzolate |
| CAS Number | 25990-43-6 |
| Groups | approved withdrawn |
| ATC Codes | A03AB12 |
| Description | Mepenzolate is a post-ganglionic parasympathetic inhibitor. It decreases gastric acid and pepsin secretion and suppresses spontaneous contractions of the colon. Mepenzolate diminishes gastric acid and pepsin secretion. Mepenzolate also suppresses spontaneous contractions of the colon. Pharmacologica... |
Categories: Acids, Carbocyclic Agents producing tachycardia Alimentary Tract and Metabolism Anticholinergic Agents Diphenylacetic Acids Drugs for Functional Gastrointestinal Disorders Hydroxy Acids Muscarinic Antagonists Phenylacetates Synthetic Anticholinergics, Quaternary Ammonium Compounds
Cross-references: BindingDB: 50377964 ChEBI: 94411 CHEMBL524004 ChemSpider: 3917 C07818 PharmGKB: PA164746250 PubChem:4057 PubChem:46508905 RxCUI: 107770 Therapeutic Targets Database: DAP001115 Wikipedia: Mepenzolate