Molecule Details
| InChIKey | GKGRZLGAQZPEHO-UHFFFAOYSA-N |
|---|---|
| Compound Name | Radiprodil |
| Canonical SMILES | O=C(Nc1ccc2nc(O)oc2c1)C(=O)N1CCC(Cc2ccc(F)cc2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.22 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12260 |
|---|---|
| Drug Name | Radiprodil |
| CAS Number | 496054-87-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Radiprodil has been used in trials studying the treatment of Infantile Spasms (IS) and Diabetic Peripheral Neuropathic Pain. |
Categories: Acetates Acids, Acyclic Amides
Cross-references: BindingDB: 50149684 CHEMBL182066 ChemSpider: 8376312 PubChem:10200813 PubChem:347828533 ZINC: ZINC000028363953
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O15399 | GRIN2D | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
| O60391 | GRIN3B | Homo sapiens | Human | PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.2 | IC50 | ChEMBL;BindingDB |
| Q12879 | GRIN2A | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.2 | IC50 | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.2 | IC50 | ChEMBL |
| Q14957 | GRIN2C | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.2 | IC50 | ChEMBL |
| Q8TCU5 | GRIN3A | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q13224 | GRIN2B | Glutamate receptor ionotropic, NMDA 2B | antagonist | targets |