Molecule Details
| InChIKey | GDXBRVCQGGKXJY-UHFFFAOYSA-N |
|---|---|
| Compound Name | Zoniporide |
| Canonical SMILES | N=C(N)NC(=O)c1cnn(-c2cccc3ncccc23)c1C1CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.87 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20312 |
|---|---|
| Drug Name | Zoniporide |
| CAS Number | 241800-98-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Zoniporide is a small molecule drug. The usage of the INN stem '-poride' in the name indicates that Zoniporide is a Na+/H+ antiport inhibitor. Zoniporide has a monoisotopic molecular weight of 320.14 Da. |
Categories: Amidines
Cross-references: BindingDB: 50097898 CHEMBL355862 ZINC: ZINC000003933046