Molecule Details
| InChIKey | FYXRSVDHGLUMHB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ly-2584702 |
| Canonical SMILES | Cn1cc(-c2ccc(F)c(C(F)(F)F)c2)nc1C1CCN(c2ncnc3[nH]ncc23)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.19 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12690 |
|---|---|
| Drug Name | LY-2584702 |
| CAS Number | 1082949-67-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | LY2584702 has been used in trials studying the treatment of Cancer, Advanced Cancer, Renal Cell Carcinoma, Metastases, Neoplasm, and Neuroendocrine Tumors, among others. |
Categories: Ribosomal Protein S6 Kinases, 70-kDa, antagonists & inhibitors
Cross-references: CHEMBL3545076 ChemSpider: 25069691 PubChem:25118925 PubChem:347828891 ZINC: ZINC000043204100
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P23443 | RPS6KB1 | Homo sapiens | Human | PF00069 PF00433 | 8.4 | IC50 | ChEMBL;BindingDB |
| O75582 | RPS6KA5 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |
| O75676 | RPS6KA4 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |
| P51812 | RPS6KA3 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |
| Q15349 | RPS6KA2 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |
| Q15418 | RPS6KA1 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |
| Q9UBS0 | RPS6KB2 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |
| Q9UK32 | RPS6KA6 | Homo sapiens | Human | PF00069 PF00433 | 8.2 | IC50 | ChEMBL |