Molecule Details
| InChIKey | FWUQWDCOOWEXRY-ZDUSSCGKSA-N |
|---|---|
| Compound Name | Lanicemine |
| Canonical SMILES | N[C@@H](Cc1ccccn1)c1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.25 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11889 |
|---|---|
| Drug Name | Lanicemine |
| CAS Number | 153322-05-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Lanicemine has been used in trials studying the treatment and basic science of Depression, Major Depressive Disorder, and Treatment Resistant Major Depressive Disorder. |
Categories: Amines Antidepressive Agents Central Nervous System Depressants Ethylamines Receptors, N-Methyl-D-Aspartate, antagonists & inhibitors
Cross-references: CHEMBL467084 ChemSpider: 7969970 PubChem:9794203 PubChem:347828224 Wikipedia: Lanicemine ZINC: ZINC000000006163
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O15399 | GRIN2D | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.2 | Ki | ChEMBL |
| O60391 | GRIN3B | Homo sapiens | Human | PF00060 PF10613 | 6.2 | Ki | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.2 | Ki | ChEMBL |
| Q12879 | GRIN2A | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 6.2 | Ki | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 6.2 | Ki | ChEMBL |
| Q14957 | GRIN2C | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 6.2 | Ki | ChEMBL |
| Q8TCU5 | GRIN3A | Homo sapiens | Human | PF01094 PF00060 PF10613 | 6.2 | Ki | ChEMBL |