Molecule Details
| InChIKey | FTFRZXFNZVCRSK-UHFFFAOYSA-N |
|---|---|
| Compound Name | Falnidamol |
| Canonical SMILES | CN1CCC(Nc2ncc3ncnc(Nc4ccc(F)c(Cl)c4)c3n2)CC1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.52 |
| Source | ChEMBL;BindingDB;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12966 |
|---|---|
| Drug Name | Falnidamol |
| CAS Number | 196612-93-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Falnidamol has been used in trials studying the treatment of Unspecified Adult Solid Tumor, Protocol Specific. |
Cross-references: BindingDB: 50375639 ChEBI: 93243 CHEMBL258940 ChemSpider: 5293705 PubChem:6918508 PubChem:347829106 ZINC: ZINC000001494443
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00533 | EGFR | Epidermal growth factor receptor | antagonist | targets |