Molecule Details
| InChIKey | FPKOGTAFKSLZLD-FQEVSTJZSA-N |
|---|---|
| Canonical SMILES | N=C(N)c1ccc(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N2CCC(OCC(=O)O)CC2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.18 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20451 |
|---|---|
| Drug Name | Lamifiban |
| CAS Number | 144412-49-7 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Lamifiban is a small molecule drug. The usage of the INN stem '-fiban' in the name indicates that Lamifiban is a fibrinogen receptor antagonist (glycoprotein IIb/IIIa receptor antagonist). Lamifiban has a monoisotopic molecular weight of 468.2 Da. |
Categories: Acids, Acyclic Amino Acids Amino Acids, Aromatic Amino Acids, Cyclic Amino Acids, Peptides, and Proteins Anticoagulants Antiplatelet agents Fatty Acids Fatty Acids, Volatile Hematologic Agents Lipids
Cross-references: BindingDB: 50003874 ChEBI: 177737 CHEMBL108111 PDB: NB9