Molecule Details
| InChIKey | FONCZICQWCUXEB-RUZDIDTESA-N |
|---|---|
| Canonical SMILES | Cc1cc(-c2c3ccccc3c(Br)c3sc(C)c(C)c23)cc(C)c1O[C@H](Cc1ccccc1)C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.41 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06521 |
|---|---|
| Drug Name | Ertiprotafib |
| CAS Number | 251303-04-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Ertiprotafib belongs to a novel class of insulin sensitizers developed for treatment of type 2 diabetes. In insulin-resistant rodent models, ertiprotafib and a close analog lowered both fasting blood glucose and insulin levels and improved glycemic excursion during an oral glucose tolerance test. |
Categories: Acids, Carbocyclic Sulfur Compounds
Cross-references: BindingDB: 50209683 CHEMBL184041 ChemSpider: 138230 ZINC: ZINC000001547338
Target Activities (2)
DrugBank Target Actions (4)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O14920 | IKBKB | Inhibitor of nuclear factor kappa-B kinase subunit beta | binder | targets |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | binder | targets |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | binder | targets |
| P18031 | PTPN1 | Tyrosine-protein phosphatase non-receptor type 1 | inhibitor | targets |