Molecule Details
| InChIKey | FOFDIMHVKGYHRU-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | S=C(NCc1ccc2c(c1)OCO2)N1CCN(c2ncnc3c2oc2ccccc23)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.21 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12742 |
|---|---|
| Drug Name | Amuvatinib |
| CAS Number | 850879-09-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Amuvatinib has been used in trials studying the treatment of Solid Tumors and Small Cell Lung Carcinoma. Amuvatinib is an oral, selective multi-targeted tyrosine kinase inhibitor that suppresses c-MET, c-RET and the mutant forms of c-KIT, PDGFR and FLT3. Amuvatinib also suppresses Rad51 protein, a c... |
Categories: Amides Sulfur Compounds
Cross-references: BindingDB: 50172081 ChEBI: 91389 CHEMBL2103851 ChemSpider: 9457280 PubChem:11282283 PubChem:347828932 ZINC: ZINC000034951302
Target Activities (2)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P07949 | RET | Proto-oncogene tyrosine-protein kinase receptor Ret | binder | targets |
| P08581 | MET | Hepatocyte growth factor receptor | binder | targets |
| P36888 | FLT3 | Receptor-type tyrosine-protein kinase FLT3 | binder | targets |
| Q06609 | RAD51 | DNA repair protein RAD51 homolog 1 | binder | targets |
| P10721 | KIT | Mast/stem cell growth factor receptor Kit | modulator | targets |
| P16234 | PDGFRA | Platelet-derived growth factor receptor alpha | modulator | targets |