Molecule Details
| InChIKey | FLOSMHQXBMRNHR-QPJJXVBHSA-N |
|---|---|
| Canonical SMILES | CC(=O)/N=c1/sc(S(N)(=O)=O)nn1C |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 18 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.45 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00703 |
|---|---|
| Drug Name | Methazolamide |
| CAS Number | 554-57-4 |
| Groups | approved |
| ATC Codes | G01AE10 S01EC05 |
| Description | A carbonic anhydrase inhibitor that is used as a diuretic and in the treatment of glaucoma. |
Categories: Antiglaucoma Preparations and Miotics Carbonic Anhydrase Inhibitors Cardiovascular Agents Diuretics Drugs causing inadvertant photosensitivity Enzyme Inhibitors Genito Urinary System and Sex Hormones Gynecological Antiinfectives and Antiseptics Hypotensive Agents Natriuretic Agents OAT1/SLC22A6 inhibitors Ophthalmologicals Photosensitizing Agents Sensory Organs Sulfonamides Sulfur Compounds Thiadiazoles Thiazoles
Cross-references: BindingDB: 50013792 ChEBI: 6822 CHEMBL19 ChemSpider: 10438315 Drugs Product Database (DPD): 5863 C07764 D00655 PharmGKB: PA450413 PubChem:4100 PubChem:46506393 RxCUI: 6826 Therapeutic Targets Database: DAP000599 Wikipedia: Methazolamide ZINC: ZINC000100019188
Target Activities (18)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P43166 | CA7 | Homo sapiens | Human | PF00194 | 8.7 | Ki | ChEMBL;BindingDB |
| O43570 | CA12 | Homo sapiens | Human | PF00194 | 8.5 | Ki | ChEMBL;BindingDB |
| P07451 | CA3 | Homo sapiens | Human | PF00194 | 8.3 | IC50 | ChEMBL |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 8.1 | pIC50 | TTD_MultiTarget |
| P23280 | CA6 | Homo sapiens | Human | PF00194 | 8.0 | Ki | ChEMBL |
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 7.8 | Ki | ChEMBL;BindingDB |
| Q8N1Q1 | CA13 | Homo sapiens | Human | PF00194 | 7.7 | IC50 | ChEMBL |
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 7.6 | Ki | ChEMBL;BindingDB |
| Q9ULX7 | CA14 | Homo sapiens | Human | PF00194 | 7.4 | Ki | ChEMBL |
| P00915 | CA1 | Homo sapiens | Human | PF00194 | 7.3 | Ki | ChEMBL;BindingDB |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 7.2 | Ki | ChEMBL |
| P35218 | CA5A | Homo sapiens | Human | PF00194 | 7.2 | Ki | ChEMBL |
| P22748 | CA4 | Homo sapiens | Human | PF00194 | 7.2 | IC50 | ChEMBL |
| Q3I4V7 | CAN2 | Cryptococcus neoformans | Pathogen | PF00484 | 7.2 | Ki | ChEMBL |
| Q6FTL6 | NCE103 | Candida glabrata (strain ATCC 2001 / BCRC 20586 / JCM 3761 / NBRC 0622 / NRRL Y-65 / CBS 138) | Pathogen | PF00484 | 6.9 | Ki | ChEMBL |
| O24855 | cynT | Helicobacter pylori (strain ATCC 700392 / 26695) | Pathogen | PF00484 | 6.7 | Ki | ChEMBL |
| P9WPJ9 | mtcA2 | Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) | Pathogen | PF00484 | 6.2 | Ki | ChEMBL |
| P9WPJ7 | mtcA1 | Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) | Pathogen | PF00484 | 6.1 | Ki | ChEMBL |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00915 | CA1 | Carbonic anhydrase 1 | inhibitor | targets |
| P00918 | CA2 | Carbonic anhydrase 2 | inhibitor | targets |
| P07451 | CA3 | Carbonic anhydrase 3 | inhibitor | targets |
| P22748 | CA4 | Carbonic anhydrase 4 | inhibitor | targets |
| P43166 | CA7 | Carbonic anhydrase 7 | inhibitor | targets |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 | inhibitor | transporters |