Molecule Details
| InChIKey | FLNYCRJBCNNHRH-OIYLJQICSA-N |
|---|---|
| Compound Name | Serlopitant |
| Canonical SMILES | C[C@@H](O[C@H]1CC[C@@H]2CN(C3=CC(=O)CC3)C[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.79 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12973 |
|---|---|
| Drug Name | Serlopitant |
| CAS Number | 860642-69-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Serlopitant has been investigated for the treatment of Prurigo Nodularis. |
Categories: Heterocyclic Compounds, Fused-Ring Neurokinin-1 Receptor Antagonists Neurotransmitter Agents
Cross-references: BindingDB: 50277511 CHEMBL447955 ChemSpider: 24686685 PubChem:23653789 PubChem:347829113 Wikipedia: Serlopitant
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P25103 | TACR1 | Substance-P receptor | antagonist | targets |