Molecule Details
| InChIKey | FKCMADOPPWWGNZ-YUMQZZPRSA-N |
|---|---|
| Compound Name | Talabostat |
| Canonical SMILES | CC(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.74 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06182 |
|---|---|
| Drug Name | Talabostat |
| CAS Number | 149682-77-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | nan |
Categories: Acids Acids, Noncarboxylic Amino Acids, Peptides, and Proteins Boron Compounds Dipeptidyl-Peptidases and Tripeptidyl-Peptidases, antagonists & inhibitors Oligopeptides Peptides
Cross-references: BindingDB: 50050513 CHEMBL67279 ChemSpider: 5293769 ZINC: ZINC000169746694
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27487 | DPP4 | Homo sapiens | Human | PF00930 PF00326 | 8.7 | IC50 | ChEMBL;BindingDB |
| Q86TI2 | DPP9 | Homo sapiens | Human | PF19520 PF00930 PF00326 | 8.7 | IC50 | ChEMBL;BindingDB |
| Q6V1X1 | DPP8 | Homo sapiens | Human | PF19520 PF00930 PF00326 | 8.3 | IC50 | ChEMBL;BindingDB |
| Q12884 | FAP | Homo sapiens | Human | PF00930 PF00326 | 7.7 | IC50 | ChEMBL;BindingDB |
| Q9UHL4 | DPP7 | Homo sapiens | Human | PF05577 | 7.1 | IC50 | ChEMBL;BindingDB |
| P48147 | PREP | Homo sapiens | Human | PF00326 PF02897 | 6.0 | IC50 | ChEMBL;BindingDB |