Molecule Details
| InChIKey | FJAQNRBDVKIIKK-LFLQOBSNSA-N |
|---|---|
| Compound Name | Clorobiocin |
| Canonical SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)[nH]2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2Cl)OC1(C)C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.5 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB03966 |
|---|---|
| Drug Name | Clorobiocin |
| CAS Number | 39868-96-7 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Clorobiocin is an aminocoumarin antibiotic, similar to [novobiocin] and coumermycin A1. |
Categories: Aminocoumarins Benzopyrans Carbohydrates Coumarins Glycosides Heterocyclic Compounds, Fused-Ring Pyrans
Cross-references: BindingDB: 50330317 CHEMBL303984 ChemSpider: 21256053 C12032 PDB: CBN PubChem:54706138 PubChem:46505267 Wikipedia: Clorobiocin ZINC: ZINC000004102306