Molecule Details
| InChIKey | FIMYFEGKMOCQKT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ro-4987655 |
| Canonical SMILES | O=C(NOCCO)c1cc(CN2OCCCC2=O)c(F)c(F)c1Nc1ccc(I)cc1F |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.17 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12933 |
|---|---|
| Drug Name | RO-4987655 |
| CAS Number | 874101-00-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | RO4987655 has been used in trials studying the treatment of Neoplasms. |
Categories: Acids, Carbocyclic Amides Benzene Derivatives Benzoates
Cross-references: BindingDB: 50338038 CHEMBL1614766 ChemSpider: 9723409 PDB: 3OR PubChem:11548630 PubChem:347829078 ZINC: ZINC000043103796