Molecule Details
| InChIKey | FFBDFADSZUINTG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Dpcpx |
| Canonical SMILES | CCCn1c(=O)c2[nH]c(C3CCCC3)nc2n(CCC)c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.1 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12946 |
|---|---|
| Drug Name | DPCPX |
| CAS Number | 102146-07-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CPX has been used in trials studying the treatment of Cystic Fibrosis. |
Categories: Adenosine A1 Receptor Antagonists Alkaloids Heterocyclic Compounds, Fused-Ring Neurotransmitter Agents Purinergic Agents Purinergic Antagonists Purinergic P1 Receptor Antagonists Purines Purinones
Cross-references: BindingDB: 21173 ChEBI: 73282 CHEMBL183 ChemSpider: 1289 C13709 PubChem:1329 PubChem:347829089 Wikipedia: Dipropylcyclopentylxanthine ZINC: ZINC000003977757
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P30542 | ADORA1 | Homo sapiens | Human | PF00001 | 8.5 | Ki | ChEMBL;BindingDB |
| P29275 | ADORA2B | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P29274 | ADORA2A | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL;BindingDB |
| P0DMS8 | ADORA3 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (5)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P0DMS8 | ADORA3 | Adenosine receptor A3 | inhibitor | targets |
| P21589 | NT5E | 5'-nucleotidase | inhibitor | targets |
| P29274 | ADORA2A | Adenosine receptor A2a | inhibitor | targets |
| P29275 | ADORA2B | Adenosine receptor A2b | inhibitor | targets |
| P30542 | ADORA1 | Adenosine receptor A1 | inhibitor | targets |