Molecule Details
| InChIKey | FEBOTPHFXYHVPL-UHFFFAOYSA-N |
|---|---|
| Compound Name | Benperidol |
| Canonical SMILES | O=C(CCCN1CCC(n2c(=O)[nH]c3ccccc32)CC1)c1ccc(F)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.8 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12867 |
|---|---|
| Drug Name | Benperidol |
| CAS Number | 2062-84-2 |
| Groups | approved withdrawn |
| ATC Codes | N05AD07 |
| Description | Benperidol has been used in trials studying the treatment of Dementia, Depression, Schizophrenia, Anxiety Disorders, and Psychosomatic Disorders, among others. |
Categories: Antipsychotic Agents Butyrophenone Derivatives Butyrophenones Central Nervous System Agents Central Nervous System Depressants Dopamine Agents Dopamine Antagonists Ketones Nervous System Neurotoxic agents Neurotransmitter Agents Psycholeptics Psychotropic Drugs Tranquilizing Agents
Cross-references: BindingDB: 81492 ChEBI: 93403 CHEMBL297302 ChemSpider: 15521 PubChem:16363 PubChem:347829025 RxCUI: 1373 Wikipedia: Benperidol ZINC: ZINC000009232411
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 10.6 | Ki | ChEMBL;BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 10.2 | Ki | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 9.5 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.9 | Ki | ChEMBL;BindingDB |