Molecule Details
| InChIKey | FBOUYBDGKBSUES-VXKWHMMOSA-N |
|---|---|
| Compound Name | Solifenacin |
| Canonical SMILES | O=C(O[C@H]1CN2CCC1CC2)N1CCc2ccccc2[C@@H]1c1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.11 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01591 |
|---|---|
| Drug Name | Solifenacin |
| CAS Number | 242478-37-1 |
| Groups | approved investigational |
| ATC Codes | G04BD08 G04CA53 |
| Description | Solifenacin is a competitive muscarinic receptor antagonist indicated to treat an overactive bladder with urinary incontinence, urgency, and frequency.[L7511] It has a long duration of action as it is usually taken once daily.[L7511] Solifenacin was granted FDA approval on 19 November 2004.[L7511] |
Categories: Agents producing tachycardia Agents that produce hypertension Anticholinergic Agents Cholinergic Agents Cytochrome P-450 CYP1A1 Substrates Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Drugs Used in Benign Prostatic Hypertrophy Drugs for Urinary Frequency and Incontinence Genito Urinary System and Sex Hormones Genitourinary Agents Heterocyclic Compounds, Fused-Ring Isoquinolines Muscarinic Antagonists Neurotransmitter Agents Potential QTc-Prolonging Agents QTc Prolonging Agents Quinuclidines Tetrahydroisoquinolines Urological Agents Urologicals
Cross-references: BindingDB: 50370682 ChEBI: 135530 CHEMBL1734 ChemSpider: 135771 Drugs Product Database (DPD): 18175 D08522 PharmGKB: PA164783810 PubChem:154059 PubChem:46506006 RxCUI: 322167 Therapeutic Targets Database: DAP001129 Wikipedia: Solifenacin ZINC: ZINC000003936683
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 7.6 | IC50 | ChEMBL;BindingDB |
| P08912 | CHRM5 | Homo sapiens | Human | PF00001 | 7.4 | Ki | ChEMBL;BindingDB |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 7.3 | Ki | ChEMBL;BindingDB |
| P08172 | CHRM2 | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| Q12809 | KCNH2 | Homo sapiens | Human | PF00027 PF00520 PF13426 | 6.6 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (9)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | alpha1-acid glycoprotein | binder | carriers |
| P04798 | CYP1A1 | Cytochrome P450 1A1 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P08172 | CHRM2 | Muscarinic acetylcholine receptor M2 | antagonist | targets |
| P08173 | CHRM4 | Muscarinic acetylcholine receptor M4 | antagonist | targets |
| P08912 | CHRM5 | Muscarinic acetylcholine receptor M5 | antagonist | targets |
| P11229 | CHRM1 | Muscarinic acetylcholine receptor M1 | antagonist | targets |
| P20309 | CHRM3 | Muscarinic acetylcholine receptor M3 | antagonist | targets |