Molecule Details
| InChIKey | FBKMWOJEPMPVTQ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Incb24360 |
| Canonical SMILES | NS(=O)(=O)NCCNc1nonc1/C(=N/O)Nc1ccc(F)c(Br)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.73 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11717 |
|---|---|
| Drug Name | Epacadostat |
| CAS Number | 1204669-58-8 |
| Groups | investigational |
| ATC Codes | L01XX58 |
| Description | Epacadostat has been used in trials studying the treatment of HL, Melanoma, Glioblastoma, Mucosal Melanoma, and Ovarian Carcinoma, among others. |
Categories: Amides Amines Antineoplastic Agents Antineoplastic and Immunomodulating Agents Hydroxylamines Sulfones Sulfur Compounds
Cross-references: BindingDB: 50126143 CHEMBL3545369 ChemSpider: 34448418 PDB: BBJ PubChem:91826917 PubChem:347828080 Wikipedia: Epacadostat ZINC: ZINC000113208009
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P14902 | IDO1 | Indoleamine 2,3-dioxygenase 1 | inhibitor | targets |