Molecule Details
| InChIKey | DURULFYMVIFBIR-UHFFFAOYSA-N |
|---|---|
| Compound Name | Practolol |
| Canonical SMILES | CC(=O)Nc1ccc(OCC(O)CNC(C)C)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.43 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01297 |
|---|---|
| Drug Name | Practolol |
| CAS Number | 6673-35-4 |
| Groups | approved |
| ATC Codes | C07AB01 |
| Description | A beta-adrenergic antagonist that has been used in the emergency treatment of cardiac arrhythmias. |
Categories: Acetanilides Adrenergic Agents Adrenergic Antagonists Adrenergic beta-1 Receptor Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Alcohols Amides Amines Amino Alcohols Anilides Aniline Compounds Antiarrhythmic agents Antihypertensive Agents Beta Blocking Agents, Selective Bradycardia-Causing Agents Cardiovascular Agents Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 Substrates Neurotransmitter Agents Phenoxypropanolamines Propanolamines Propanols
Cross-references: BindingDB: 25749 ChEBI: 258351 CHEMBL6995 ChemSpider: 4715 C11696 D05587 PharmGKB: PA164752820 PubChem:4883 PubChem:46507496 RxCUI: 8620 Therapeutic Targets Database: DAP000940 Wikipedia: Practolol