Molecule Details
| InChIKey | DUPWHXBITIZIKZ-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | Cc1cn(-c2cc(NC(=O)c3ccc(C)c(Nc4nccc(-c5cnccn5)n4)c3)cc(C(F)(F)F)c2)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.92 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12323 |
|---|---|
| Drug Name | Radotinib |
| CAS Number | 926037-48-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Radotinib is under investigation for the treatment of Leukemia, Myelogenous, Chronic, BCR-ABL Positive. |
Categories: Acids, Carbocyclic Amides Benzene Derivatives Benzoates Tyrosine Kinase Inhibitors
Cross-references: ChemSpider: 17222861 PubChem:16063245 PubChem:347828586 Wikipedia: Radotinib ZINC: ZINC000059749972
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00519 | ABL1 | Tyrosine-protein kinase ABL1 | antagonist | targets |