Molecule Details
| InChIKey | DRHKJLXJIQTDTD-OAHLLOKOSA-N |
|---|---|
| Compound Name | Tamsulosin |
| Canonical SMILES | CCOc1ccccc1OCCN[C@H](C)Cc1ccc(OC)c(S(N)(=O)=O)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 9 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.56 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00706 |
|---|---|
| Drug Name | Tamsulosin |
| CAS Number | 106133-20-4 |
| Groups | approved investigational |
| ATC Codes | G04CA52 G04CA02 G01AE10 G04CA54 G04CA53 |
| Description | Tamsulosin is a selective alpha-1A and alpha-1B adrenoceptor antagonist that exerts its greatest effect in the prostate and bladder, where these receptors are most common.[Label] It is indicated for the treatment of signs and symptoms of benign prostatic hypertrophy.[Label] Antagonism of these recep... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Amides Benzene Derivatives Benzenesulfonamides Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Drugs Used in Benign Prostatic Hypertrophy Drugs that are Mainly Renally Excreted Genito Urinary System and Sex Hormones Genitourinary Agents Gynecological Antiinfectives and Antiseptics Hypotensive Agents Neurotransmitter Agents Peripheral alpha-1 blockers Selective Alfa-1-adrenergic Blocking Agents Sulfonamides Sulfones Sulfur Compounds Urological Agents Urologicals
Cross-references: BindingDB: 50060964 ChEBI: 9398 CHEMBL836 ChemSpider: 114457 Drugs Product Database (DPD): 11780 Guide to Pharmacology: 488 IUPHAR: 488 C07124 PDB: JGX PharmGKB: PA451583 PubChem:129211 PubChem:46507763 RxCUI: 77492 Therapeutic Targets Database: DAP000086 Wikipedia: Tamsulosin ZINC: ZINC000001530694
Target Activities (9)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 9.7 | Ki | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 9.7 | Ki | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 9.6 | Ki | ChEMBL;BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 9.1 | Ki | ChEMBL;BindingDB |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 8.7 | Ki | ChEMBL;BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 8.1 | Ki | ChEMBL;BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 7.5 | Ki | ChEMBL;BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 7.5 | Ki | ChEMBL;BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 7.1 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P25100 | ADRA1D | Alpha-1D adrenergic receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1A adrenergic receptor | antagonist | targets |
| P35368 | ADRA1B | Alpha-1B adrenergic receptor | antagonist | targets |