Molecule Details
| InChIKey | DNTVXDZWVOVLOD-GDNBJRDFSA-N |
|---|---|
| Canonical SMILES | CCOC(=O)C1=C(NN2CCN(CC(F)(F)F)CC2)O/C(=C\c2c[nH]c3ncccc23)C1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.96 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21619 |
|---|---|
| Drug Name | Monzosertib |
| CAS Number | 1402057-88-8 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Monzosertib is a small molecule drug. The usage of the INN stem '-sertib' in the name indicates that Monzosertib is a serine/threonine kinase inhibitor. Monzosertib has a monoisotopic molecular weight of 465.16 Da. |
Cross-references: BindingDB: 50574282 CHEMBL4868568
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P11309 | PIM1 | Homo sapiens | Human | PF00069 | 7.5 | IC50 | ChEMBL;BindingDB |
| O00311 | CDC7 | Homo sapiens | Human | PF00069 | 7.4 | IC50 | ChEMBL;BindingDB |
| P49759 | CLK1 | Homo sapiens | Human | PF00069 | 6.7 | IC50 | ChEMBL;BindingDB |
| P49840 | GSK3A | Homo sapiens | Human | PF00069 | 6.7 | IC50 | ChEMBL;BindingDB |
| P49760 | CLK2 | Homo sapiens | Human | PF00069 | 6.6 | IC50 | ChEMBL;BindingDB |