Molecule Details
| InChIKey | DNBPMBJFRRVTSJ-UHFFFAOYSA-N |
|---|---|
| Compound Name | 5-Methoxy-N,N-Diisopropyltryptamine |
| Canonical SMILES | COc1ccc2[nH]cc(CCN(C(C)C)C(C)C)c2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.6 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01441 |
|---|---|
| Drug Name | 5-Methoxy-N,N-diisopropyltryptamine |
| CAS Number | 4021-34-5 |
| Groups | experimental illicit |
| ATC Codes | nan |
| Description | 5-methoxy-N,N-diisopropyltryptamine (5-MeO-DIPT) is a tryptamine derivative and shares many similarities with schedule I tryptamine hallucinogens such as alpha-ethyltryptamine, N,N-dimethyltryptamine, N,N-diethyltryptamine, bufotenine, psilocybin and psilocin. Since 1999, there has been a growing po... |
Categories: Alkaloids Amines Biogenic Amines Biogenic Monoamines Heterocyclic Compounds, Fused-Ring Indoles Morphinans Morphine Derivatives Opiate Alkaloids Phenanthrenes Tryptamines
Cross-references: BindingDB: 707612 ChEBI: 48282 CHEMBL2140942 ChemSpider: 133247 PubChem:151182 PubChem:46506676 Wikipedia: 5-Methoxy-diisopropyltryptamine ZINC: ZINC000002583773