Molecule Details
| InChIKey | DJEIHHYCDCTAAH-UHFFFAOYSA-N |
|---|---|
| Compound Name | Mofezolac |
| Canonical SMILES | COc1ccc(-c2noc(CC(=O)O)c2-c2ccc(OC)cc2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.61 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21153 |
|---|---|
| Drug Name | Mofezolac |
| CAS Number | 78967-07-4 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Mofezolac is a small molecule drug. The usage of the INN stem '-ac' in the name indicates that Mofezolac is a anti-inflammatory agent, ibufenac derivative. Mofezolac has a monoisotopic molecular weight of 339.11 Da. |
Categories: Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Antirheumatic Agents Cyclooxygenase 1 Cyclooxygenase Inhibitors Enzyme Inhibitors Peripheral Nervous System Agents Sensory System Agents
Cross-references: BindingDB: 50376383 ChEBI: 31860 CHEMBL259972 PDB: 63X RxCUI: 11469 ZINC: ZINC000000003767