Molecule Details
| InChIKey | DHCOPPHTVOXDKU-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tofimilast |
| Canonical SMILES | CCc1nn(C2CCCC2)c2c1CCn1c(-c3cccs3)nnc1-2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.81 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11681 |
|---|---|
| Drug Name | Tofimilast |
| CAS Number | 185954-27-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tofimilast has been used in trials studying the treatment of Asthma and Pulmonary Disease, Chronic Obstructive. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50202528 CHEMBL217899 ChemSpider: 8071932 PubChem:9896267 PubChem:347828048 ZINC: ZINC000000021914