Molecule Details
| InChIKey | DENYZIUJOTUUNY-MRXNPFEDSA-N |
|---|---|
| Compound Name | Pamiparib |
| Canonical SMILES | C[C@]12CCCN1CC1=NNC(=O)c3cc(F)cc4[nH]c2c1c34 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.6 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14769 |
|---|---|
| Drug Name | Pamiparib |
| CAS Number | 1446261-44-4 |
| Groups | investigational |
| ATC Codes | L01XK06 |
| Description | Pamiparib is under investigation in clinical trial NCT03933761 (Pamiparib in Fusion Positive, Reversion Negative High Grade Serous Ovarian Cancer or Carcinosarcoma With BRCA1/2 Gene Mutations If Progression on Substrate Poly ADP Ribose Polymerase Inhibitbor (PARPI) or Chemotherapy). |
Categories: Antineoplastic Agents Antineoplastic and Immunomodulating Agents Enzyme Inhibitors Poly (ADP-ribose) polymerase (PARP) inhibitors Poly(ADP-ribose) Polymerase Inhibitors
Cross-references: CHEMBL4112930 ChemSpider: 58805610 PDB: DS9 ZINC: ZINC000150196116
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q9UGN5 | PARP2 | Homo sapiens | Human | PF00644 PF02877 PF05406 | 9.1 | IC50 | ChEMBL;BindingDB |
| P09874 | PARP1 | Homo sapiens | Human | PF00533 PF21728 PF00644 PF02877 PF05406 PF00645 PF08063 | 8.9 | IC50 | ChEMBL;BindingDB |
| Q9Y6F1 | PARP3 | Homo sapiens | Human | PF00644 PF02877 PF05406 | 7.0 | IC50 | ChEMBL;BindingDB |
| O95271 | TNKS | Homo sapiens | Human | PF00023 PF12796 PF00644 PF07647 | 6.6 | IC50 | ChEMBL;BindingDB |
| Q9H2K2 | TNKS2 | Homo sapiens | Human | PF00023 PF12796 PF13637 PF00644 PF07647 | 6.5 | IC50 | ChEMBL;BindingDB |