Molecule Details
| InChIKey | DDLIGBOFAVUZHB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Midazolam |
| Canonical SMILES | Cc1ncc2n1-c1ccc(Cl)cc1C(c1ccccc1F)=NC2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.21 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00683 |
|---|---|
| Drug Name | Midazolam |
| CAS Number | 59467-70-8 |
| Groups | approved illicit investigational |
| ATC Codes | N05CD08 |
| Description | Midazolam is a short-acting hypnotic-sedative drug with anxiolytic, muscle relaxant, anticonvulsant, sedative, hypnotic, and amnesic properties.[A173842] It belongs to a class of drugs called _benzodiazepines_. This drug is unique from others in this class due to its rapid onset of effects and short... |
Categories: Adjuvants, Anesthesia Anesthetics Anti-Anxiety Agents Benzodiazepine hypnotics and sedatives Benzodiazepines and benzodiazepine derivatives Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted GABA Agents GABA Modulators Heterocyclic Compounds, Fused-Ring Hypnotics and Sedatives Nervous System Neurotransmitter Agents P-glycoprotein substrates Psycholeptics Psychotropic Drugs Tranquilizing Agents Triazolobenzodiazepines UGT1A4 substrates UGT2B7 substrates
Cross-references: BindingDB: 21363 ChEBI: 6931 CHEMBL655 ChemSpider: 4047 Drugs Product Database (DPD): 11188 Guide to Pharmacology: 3342 IUPHAR: 3342 C07524 D00550 PDB: 08J PharmGKB: PA450496 PubChem:4192 PubChem:46507611 RxCUI: 6960 Therapeutic Targets Database: DAP000241 Wikipedia: Midazolam ZINC: ZINC000095626706
Target Activities (3)
DrugBank Target Actions (15)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P06133 | P06133 | UDP-glucuronosyltransferase 2B4 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P22310 | P22310 | UDP-glucuronosyltransferase 1A4 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P14867 | GABRA1 | GABA(A) Receptor Benzodiazepine Binding Site | ligand | targets |
| P30536 | TSPO | Translocator protein | modulator | targets |
| P14867 | GABRA1 | GABA(A) Receptor | positive allosteric modulator | targets |
| P29274 | ADORA2A | Adenosine receptor A2a | potentiator | targets |
| P43004 | SLC1A2 | Excitatory amino acid transporter 2 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |