Molecule Details
| InChIKey | DBPWSSGDRRHUNT-CEGNMAFCSA-N |
|---|---|
| Compound Name | 17-Hydroxyprogesterone |
| Canonical SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.4 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14570 |
|---|---|
| Drug Name | Hydroxyprogesterone |
| CAS Number | 68-96-2 |
| Groups | investigational |
| ATC Codes | G03FA02 G03DA03 |
| Description | nan |
Categories: Adrenal Cortex Hormones Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Fused-Ring Compounds Genito Urinary System and Sex Hormones Gonadal Hormones Gonadal Steroid Hormones Hormones Hormones, Hormone Substitutes, and Hormone Antagonists Hydroxyprogesterones Pregnanes Pregnen (4) Derivatives Pregnenediones Pregnenes Progesterone Congeners Progesterone and Derivatives Progestins Sex Hormones and Modulators of the Genital System Steroids
Cross-references: BindingDB: 50423511 ChEBI: 17252 CHEMBL1062 ChemSpider: 6002 C01176 PDB: 3QZ RxCUI: 5542 Wikipedia: 17%CE%B1-Hydroxyprogesterone ZINC: ZINC000005434436
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |