Molecule Details
| InChIKey | DBEPLOCGEIEOCV-WSBQPABSSA-N |
|---|---|
| Compound Name | Finasteride |
| Canonical SMILES | CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4NC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.04 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01216 |
|---|---|
| Drug Name | Finasteride |
| CAS Number | 98319-26-7 |
| Groups | approved investigational |
| ATC Codes | D11AX10 G04CA55 G04CA51 G04CB51 G04CB01 |
| Description | Finasteride is a synthetic 4-azasteroid compound [L10565] and specific inhibitor of steroid Type II 5α-reductase, which is an intracellular enzyme that converts the androgen testosterone into 5α-dihydrotestosterone (DHT). It works in a similar fashion as [dutasteride], which is another 5-alpha-reduc... |
Categories: 5-alpha Reductase Inhibitors Adrenergic Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Androstanes Androstenes Azasteroids Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Substrates Dermatologicals Drugs Used in Benign Prostatic Hypertrophy Enzyme Inhibitors Fused-Ring Compounds Genito Urinary System and Sex Hormones Genitourinary Agents Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists Misc. Skin and Mucous Membrane Agents Steroid Synthesis Inhibitors Steroids Urological Agents Urologicals
Cross-references: BindingDB: 50334788 ChEBI: 5062 CHEMBL710 ChemSpider: 51714 Drugs Product Database (DPD): 768 D00321 PDB: FIT PharmGKB: PA449627 PubChem:57363 PubChem:46507645 RxCUI: 25025 Therapeutic Targets Database: DAP000045 Wikipedia: Finasteride ZINC: ZINC000003782599
Target Activities (3)
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P18405 | SRD5A1 | 3-oxo-5-alpha-steroid 4-dehydrogenase 1 | inhibitor | targets |
| P31213 | SRD5A2 | 3-oxo-5-alpha-steroid 4-dehydrogenase 2 | inhibitor | targets |
| P51857 | AKR1D1 | Aldo-keto reductase family 1 member D1 | inhibitor | targets |
| Q9H8P0 | Q9H8P0 | Polyprenal reductase | inhibitor | targets |
| Q91V14 | Q91V14 | Solute carrier family 12 member 5 | modulator | transporters |