Molecule Details
| InChIKey | CYVVCTRDWISRAC-KRWDZBQOSA-N |
|---|---|
| Canonical SMILES | Cc1c(N2CCCC2=O)cccc1S(=O)(=O)N[C@@H](CNC(=O)c1ccc(Cl)s1)C(=O)N1CCN(C)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.55 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21678 |
|---|---|
| Drug Name | Segatroxaban |
| CAS Number | 1184300-63-7 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Segatroxaban is a small molecule drug. The usage of the INN stem '-xaban' in the name indicates that Segatroxaban is a blood coagulation factor XA inhibitor, antithrombotic. Segatroxaban has a monoisotopic molecular weight of 567.14 Da. |
Cross-references: BindingDB: 50443853 CHEMBL3139247