Molecule Details
| InChIKey | CXAGHAZMQSCAKJ-WAHHBDPQSA-N |
|---|---|
| Canonical SMILES | CCO[C@@H]1OC(=O)C[C@@H]1NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3nccc4ccccc34)C(=O)N12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.92 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04875 |
|---|---|
| Drug Name | Pralnacasan |
| CAS Number | 192755-52-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Pralnacasan is an orally bioavailable pro-drug of a potent, non-peptide inhibitor of interleukin-1beta converting enzyme (ICE). |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50189360 CHEMBL437526 ChemSpider: 135089 PubChem:153270 PubChem:175426882
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P29466 | CASP1 | Caspase-1 | modulator | targets |