Molecule Details
| InChIKey | CVKJAXCQPFOAIN-VXGBXAGGSA-N |
|---|---|
| Compound Name | Cipralisant |
| Canonical SMILES | CC(C)(C)CCC#C[C@@H]1C[C@H]1c1cnc[nH]1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.85 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19761 |
|---|---|
| Drug Name | Cipralisant |
| CAS Number | 213027-19-1 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Cipralisant is a small molecule drug. The usage of the INN stem '-isant' in the name indicates that Cipralisant is a histamine H3 receptor antagonist. Cipralisant has a monoisotopic molecular weight of 216.16 Da. |
Categories: Histamine Agents Histamine Antagonists Neurotransmitter Agents Stereoisomerism
Cross-references: BindingDB: 50222968 CHEMBL278462 ZINC: ZINC000003823435
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q9Y5N1 | HRH3 | Histamine H3 receptor | binder | targets |