Molecule Details
| InChIKey | CURUTKGFNZGFSE-UHFFFAOYSA-N |
|---|---|
| Compound Name | Dicyclomine |
| Canonical SMILES | CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 10 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.68 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00804 |
|---|---|
| Drug Name | Dicyclomine |
| CAS Number | 77-19-0 |
| Groups | approved |
| ATC Codes | A03AA07 |
| Description | Dicyclomine is a muscarinic M1, M3, and M2 receptor antagonist as well as a non-competitive inhibitor of histamine and bradykinin used to treat spasms of the intestines seen in functional bowel disorder and irritable bowel syndrome.[A6556,A182555,A234659,L7967] Though it is commonly prescribed, its ... |
Categories: Acids, Carbocyclic Agents producing tachycardia Alimentary Tract and Metabolism Anticholinergic Agents Antimuscarinics Antispasmodics Autonomic Agents Cholinergic Agents Cyclohexanecarboxylic Acids Cyclohexanes Cycloparaffins Drugs for Functional Gastrointestinal Disorders Drugs that are Mainly Renally Excreted Muscarinic Antagonists Neurotransmitter Agents Parasympatholytics Peripheral Nervous System Agents Synthetic Anticholinergics, Esters With Tertiary Amino Group
Cross-references: BindingDB: 50010101 ChEBI: 4514 CHEMBL1123 ChemSpider: 2934 Drugs Product Database (DPD): 6425 Guide to Pharmacology: 355 IUPHAR: 355 C06951 PharmGKB: PA164744928 PubChem:3042 PubChem:46505371 RxCUI: 3361 Therapeutic Targets Database: DAP001118 Wikipedia: Dicycloverine ZINC: ZINC000001530613
Target Activities (10)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 9.0 | IC50 | ChEMBL |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 8.8 | IC50 | ChEMBL |
| P08912 | CHRM5 | Homo sapiens | Human | PF00001 | 8.7 | IC50 | ChEMBL |
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 8.7 | IC50 | ChEMBL |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 8.5 | IC50 | ChEMBL |
| P08172 | CHRM2 | Homo sapiens | Human | PF00001 | 7.3 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.9 | IC50 | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.4 | Ki | ChEMBL |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |