Molecule Details
| InChIKey | CSMVOZKEWSOFER-RQNOJGIXSA-N |
|---|---|
| Canonical SMILES | CN(C)[C@]1(c2ccccc2)CC[C@]2(CC1)OCCc1c3cc(F)ccc3[nH]c12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.64 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12830 |
|---|---|
| Drug Name | Cebranopadol |
| CAS Number | 863513-91-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Cebranopadol has been used in trials studying the treatment of Pain, Neoplasms, and Chronic Pain. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: CHEMBL2364605 ChemSpider: 29398942 PubChem:11848225 PubChem:347828996 Wikipedia: Cebranopadol
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35372 | OPRM1 | Homo sapiens | Human | PF00001 | 9.2 | Ki | ChEMBL;BindingDB |
| P41146 | OPRL1 | Homo sapiens | Human | PF00001 | 9.1 | Ki | ChEMBL;BindingDB |
| P41145 | OPRK1 | Homo sapiens | Human | PF00001 | 8.6 | Ki | ChEMBL;BindingDB |
| P41143 | OPRD1 | Homo sapiens | Human | PF00001 | 7.8 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P35372 | OPRM1 | Mu-type opioid receptor | modulator | targets |