Molecule Details
| InChIKey | CMVHFGNTABZQJU-HCXYKTFWSA-N |
|---|---|
| Compound Name | Bms-813160 |
| Canonical SMILES | CC(=O)N[C@@H]1C[C@H](NC(C)(C)C)CC[C@@H]1N1CC[C@H](Nc2ncnc3cc(C(C)(C)C)nn23)C1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.38 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16240 |
|---|---|
| Drug Name | BMS-813160 |
| CAS Number | 1286279-29-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | BMS-813160 is under investigation in clinical trial NCT03496662 (BMS-813160 With Nivolumab and Gemcitabine and Nab-paclitaxel in Borderline Resectable and Locally Advanced Pancreatic Ductal Adenocarcinoma (PDAC)). |
Categories: Cardiovascular Agents
Cross-references: ChemSpider: 71061479