Molecule Details
| InChIKey | CLSJNXXMIVKULC-MUUNZHRXSA-N |
|---|---|
| Canonical SMILES | COc1ccc(CCOC(c2ccccc2)(c2ccccc2)[C@H](Oc2nc(C)cc(C)n2)C(=O)O)cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.5 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20151 |
|---|---|
| Drug Name | Feloprentan |
| CAS Number | 204267-34-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Feloprentan is a small molecule drug. The usage of the INN stem '-entan' in the name indicates that Feloprentan is a endothelin receptor antagonist. Feloprentan has a monoisotopic molecular weight of 528.23 Da. |
Categories: Acids, Acyclic Endothelin Receptor Antagonists Fatty Acids Fatty Acids, Volatile Lipids Stereoisomerism
Cross-references: BindingDB: 50079424 CHEMBL316735 ZINC: ZINC000001488192