Molecule Details
| InChIKey | CHFSOFHQIZKQCR-UHFFFAOYSA-N |
|---|---|
| Compound Name | Licostinel |
| Canonical SMILES | O=c1[nH]c2cc(Cl)c(Cl)c([N+](=O)[O-])c2[nH]c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.23 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19864 |
|---|---|
| Drug Name | Licostinel |
| CAS Number | 153504-81-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Licostinel is a small molecule drug. The usage of the INN stem '-stinel' in the name indicates that Licostinel is a N-methyl-D-aspartate (NMDA) receptor co-agonist. Licostinel has a monoisotopic molecular weight of 274.95 Da. |
Categories: Excitatory Amino Acid Agents Excitatory Amino Acid Antagonists Heterocyclic Compounds, Fused-Ring Neurotransmitter Agents
Cross-references: CHEMBL289832 ZINC: ZINC000001483505
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O15399 | GRIN2D | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
| O60391 | GRIN3B | Homo sapiens | Human | PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
| Q12879 | GRIN2A | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.2 | IC50 | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.2 | IC50 | ChEMBL |
| Q14957 | GRIN2C | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.2 | IC50 | ChEMBL |
| Q8TCU5 | GRIN3A | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.2 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00734 | F2 | Prothrombin | inhibitor | targets |