Molecule Details
| InChIKey | CFBUZOUXXHZCFB-OYOVHJISSA-N |
|---|---|
| Canonical SMILES | COc1ccc([C@]2(C#N)CC[C@@H](C(=O)O)CC2)cc1OC1CCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.05 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB03849 |
|---|---|
| Drug Name | Cilomilast |
| CAS Number | 153259-65-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Cilomilast (Ariflo, SB-207,499) is a drug which was developed for the treatment of respiratory disorders such as asthma and Chronic Obstructive Pulmonary Disease (COPD). It is orally active and acts as a selective Phosphodiesterase-4 inhibitor. Following four clinical trials, the drug proved to be e... |
Categories: Acids, Carbocyclic Cyclohexanes Cycloparaffins Enzyme Inhibitors Phosphodiesterase 4 Inhibitors Phosphodiesterase Inhibitors
Cross-references: BindingDB: 50346088 CHEMBL511115 ChemSpider: 18826005 D01704 PDB: CIO PubChem:151170 PubChem:46505062 Wikipedia: Cilomilast ZINC: ZINC000100042108
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 7.2 | IC50 | ChEMBL;BindingDB |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 7.0 | IC50 | ChEMBL;BindingDB |
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 7.0 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 7.0 | IC50 | ChEMBL;BindingDB |